C19H22N4O3 — CID 171679838
methyl 4-[(1-pyridin-3-ylpiperidin-4-yl)carbamoylamino]benzoate (PubChem CID 171679838) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 4-[(1-pyridin-3-ylpiperidin-4-yl)carbamoylamino]benzoate.
| Compound Name | methyl 4-[(1-pyridin-3-ylpiperidin-4-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 171679838 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl 4-[(1-pyridin-3-ylpiperidin-4-yl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NC2CCN(c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-26-18(24)14-4-6-15(7-5-14)21-19(25)22-16-8-11-23(12-9-16)17-3-2-10-20-13-17/h2-7,10,13,16H,8-9,11-12H2,1H3,(H2,21,22,25) |
| InChIKey | UEAPKKFZFUANAC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |