C23H23N5O3 — CID 30365220
methyl 4-[[1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 30365220) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is methyl 4-[[1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 30365220 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | methyl 4-[[1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCN(c3ccc(-c4cccnc4)nn3)CC2)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-31-23(30)17-4-6-19(7-5-17)25-22(29)16-10-13-28(14-11-16)21-9-8-20(26-27-21)18-3-2-12-24-15-18/h2-9,12,15-16H,10-11,13-14H2,1H3,(H,25,29) |
| InChIKey | IYGWBFMBBDLOSR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |