C23H24N4OS — CID 121072060
N-(4-methylsulfanylphenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 121072060) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121072060 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCN(c3ccc(-c4ccccc4)nn3)CC2)cc1 |
| InChI | InChI=1S/C23H24N4OS/c1-29-20-9-7-19(8-10-20)24-23(28)18-13-15-27(16-14-18)22-12-11-21(25-26-22)17-5-3-2-4-6-17/h2-12,18H,13-16H2,1H3,(H,24,28) |
| InChIKey | BGRBGSAENGKPKO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |