C22H20BrFN4O — CID 30360960
N-(4-bromo-2-fluorophenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 30360960) has the molecular formula C22H20BrFN4O and a molecular weight of 455.33 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30360960 |
| Molecular Formula | C22H20BrFN4O |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-1-(6-phenylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)C1CCN(c2ccc(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C22H20BrFN4O/c23-17-6-7-20(18(24)14-17)25-22(29)16-10-12-28(13-11-16)21-9-8-19(26-27-21)15-4-2-1-3-5-15/h1-9,14,16H,10-13H2,(H,25,29) |
| InChIKey | SKXLHNJUWKHVNA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |