C19H28N2O3 — CID 17217886
methyl 4-[(4-tert-butylcyclohexyl)carbamoylamino]benzoate (PubChem CID 17217886) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is methyl 4-[(4-tert-butylcyclohexyl)carbamoylamino]benzoate.
| Compound Name | methyl 4-[(4-tert-butylcyclohexyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 17217886 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | methyl 4-[(4-tert-butylcyclohexyl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NC2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2,3)14-7-11-16(12-8-14)21-18(23)20-15-9-5-13(6-10-15)17(22)24-4/h5-6,9-10,14,16H,7-8,11-12H2,1-4H3,(H2,20,21,23) |
| InChIKey | SHBDSHAEMILNJJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |