C23H33F3N4O2 — CID 91511600
ethane;1-phenyl-3-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]urea;trifluoro(methoxy)methane (PubChem CID 91511600) has the molecular formula C23H33F3N4O2 and a molecular weight of 454.54 g/mol. Its IUPAC name is ethane;1-phenyl-3-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]urea;trifluoro(methoxy)methane.
| Compound Name | ethane;1-phenyl-3-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]urea;trifluoro(methoxy)methane |
|---|---|
| PubChem CID | 91511600 |
| Molecular Formula | C23H33F3N4O2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | ethane;1-phenyl-3-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]urea;trifluoro(methoxy)methane |
| SMILES | CC.COC(F)(F)F.O=C(Nc1ccccc1)NC1CCN(CCc2cccnc2)CC1 |
| InChI | InChI=1S/C19H24N4O.C2H3F3O.C2H6/c24-19(21-17-6-2-1-3-7-17)22-18-9-13-23(14-10-18)12-8-16-5-4-11-20-15-16;1-6-2(3,4)5;1-2/h1-7,11,15,18H,8-10,12-14H2,(H2,21,22,24);1H3;1-2H3 |
| InChIKey | OOUAOAFGNFMPHH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |