C18H20FN5O2 — CID 95155477
(3S)-3-[(4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 95155477) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is (3S)-3-[(4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-[(4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 95155477 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (3S)-3-[(4-fluorophenyl)carbamoylamino]-N-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N[C@H]1CCN(C(=O)NCc2cccnc2)C1 |
| InChI | InChI=1S/C18H20FN5O2/c19-14-3-5-15(6-4-14)22-17(25)23-16-7-9-24(12-16)18(26)21-11-13-2-1-8-20-10-13/h1-6,8,10,16H,7,9,11-12H2,(H,21,26)(H2,22,23,25)/t16-/m0/s1 |
| InChIKey | MYICGRPMYPBNJE-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |