C17H23FN4O2 — CID 119310459
1-(4-fluorophenyl)-3-[1-(piperidine-4-carbonyl)pyrrolidin-3-yl]urea (PubChem CID 119310459) has the molecular formula C17H23FN4O2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[1-(piperidine-4-carbonyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[1-(piperidine-4-carbonyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 119310459 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[1-(piperidine-4-carbonyl)pyrrolidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)NC1CCN(C(=O)C2CCNCC2)C1 |
| InChI | InChI=1S/C17H23FN4O2/c18-13-1-3-14(4-2-13)20-17(24)21-15-7-10-22(11-15)16(23)12-5-8-19-9-6-12/h1-4,12,15,19H,5-11H2,(H2,20,21,24) |
| InChIKey | OUQKMBTXJXAYNJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |