C21H32ClFN4O2 — CID 119734456
1-(4-fluorophenyl)-3-[1-(3-piperidin-4-ylbutanoyl)piperidin-4-yl]urea;hydrochloride (PubChem CID 119734456) has the molecular formula C21H32ClFN4O2 and a molecular weight of 426.96 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[1-(3-piperidin-4-ylbutanoyl)piperidin-4-yl]urea;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-3-[1-(3-piperidin-4-ylbutanoyl)piperidin-4-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 119734456 |
| Molecular Formula | C21H32ClFN4O2 |
| Molecular Weight | 426.96 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[1-(3-piperidin-4-ylbutanoyl)piperidin-4-yl]urea;hydrochloride |
| SMILES | CC(CC(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)CC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C21H31FN4O2.ClH/c1-15(16-6-10-23-11-7-16)14-20(27)26-12-8-19(9-13-26)25-21(28)24-18-4-2-17(22)3-5-18;/h2-5,15-16,19,23H,6-14H2,1H3,(H2,24,25,28);1H |
| InChIKey | WVZXPINTYBWEKR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |