C16H24ClFN4O2 — CID 119295427
1-[1-(4-aminobutanoyl)piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride (PubChem CID 119295427) has the molecular formula C16H24ClFN4O2 and a molecular weight of 358.85 g/mol. Its IUPAC name is 1-[1-(4-aminobutanoyl)piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride.
| Compound Name | 1-[1-(4-aminobutanoyl)piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 119295427 |
| Molecular Formula | C16H24ClFN4O2 |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[1-(4-aminobutanoyl)piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride |
| SMILES | Cl.NCCCC(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN4O2.ClH/c17-12-3-5-13(6-4-12)19-16(23)20-14-7-10-21(11-8-14)15(22)2-1-9-18;/h3-6,14H,1-2,7-11,18H2,(H2,19,20,23);1H |
| InChIKey | AOLQRTBKDYZXNW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |