C21H29FN4O2 — CID 119734449
1-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea (PubChem CID 119734449) has the molecular formula C21H29FN4O2 and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 119734449 |
| Molecular Formula | C21H29FN4O2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)NC1CCN(C(=O)CC2CC3CCC(C2)N3)CC1 |
| InChI | InChI=1S/C21H29FN4O2/c22-15-1-3-16(4-2-15)24-21(28)25-17-7-9-26(10-8-17)20(27)13-14-11-18-5-6-19(12-14)23-18/h1-4,14,17-19,23H,5-13H2,(H2,24,25,28) |
| InChIKey | LOVNRDYDIGOPKJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |