C18H27FN4O2 — CID 119734475
1-[1-[(2S)-2-amino-4-methylpentanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea (PubChem CID 119734475) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[1-[(2S)-2-amino-4-methylpentanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-[(2S)-2-amino-4-methylpentanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 119734475 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[1-[(2S)-2-amino-4-methylpentanoyl]piperidin-4-yl]-3-(4-fluorophenyl)urea |
| SMILES | CC(C)C[C@H](N)C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN4O2/c1-12(2)11-16(20)17(24)23-9-7-15(8-10-23)22-18(25)21-14-5-3-13(19)4-6-14/h3-6,12,15-16H,7-11,20H2,1-2H3,(H2,21,22,25)/t16-/m0/s1 |
| InChIKey | VYIGRJUJGMBBEL-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |