C19H28ClFN4O3 — CID 120788437
1-[1-[2-amino-2-(oxan-4-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride (PubChem CID 120788437) has the molecular formula C19H28ClFN4O3 and a molecular weight of 414.91 g/mol. Its IUPAC name is 1-[1-[2-amino-2-(oxan-4-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride.
| Compound Name | 1-[1-[2-amino-2-(oxan-4-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 120788437 |
| Molecular Formula | C19H28ClFN4O3 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[1-[2-amino-2-(oxan-4-yl)acetyl]piperidin-4-yl]-3-(4-fluorophenyl)urea;hydrochloride |
| SMILES | Cl.NC(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)CC1)C1CCOCC1 |
| InChI | InChI=1S/C19H27FN4O3.ClH/c20-14-1-3-15(4-2-14)22-19(26)23-16-5-9-24(10-6-16)18(25)17(21)13-7-11-27-12-8-13;/h1-4,13,16-17H,5-12,21H2,(H2,22,23,26);1H |
| InChIKey | YHJRWZKLGMBSHL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |