C17H22FN3O2 — CID 95302516
1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 95302516) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 95302516 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)N[C@@H]1CCN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C17H22FN3O2/c18-13-5-7-14(8-6-13)19-17(23)20-15-9-10-21(11-15)16(22)12-3-1-2-4-12/h5-8,12,15H,1-4,9-11H2,(H2,19,20,23)/t15-/m1/s1 |
| InChIKey | HIQVATGTNSODEE-OAHLLOKOSA-N |
| XLogP | 2.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |