C19H20FN3O2 — CID 95288232
1-(4-fluorophenyl)-3-[(3R)-1-(2-methylbenzoyl)pyrrolidin-3-yl]urea (PubChem CID 95288232) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(3R)-1-(2-methylbenzoyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(3R)-1-(2-methylbenzoyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 95288232 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(3R)-1-(2-methylbenzoyl)pyrrolidin-3-yl]urea |
| SMILES | Cc1ccccc1C(=O)N1CC[C@@H](NC(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13-4-2-3-5-17(13)18(24)23-11-10-16(12-23)22-19(25)21-15-8-6-14(20)7-9-15/h2-9,16H,10-12H2,1H3,(H2,21,22,25)/t16-/m1/s1 |
| InChIKey | JQXQKQZMJUZBBL-MRXNPFEDSA-N |
| XLogP | 3.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |