C19H21FN4O3 — CID 155947310
1-[1-(2-ethyl-6-oxo-1H-pyridine-4-carbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 155947310) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[1-(2-ethyl-6-oxo-1H-pyridine-4-carbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-(2-ethyl-6-oxo-1H-pyridine-4-carbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 155947310 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[1-(2-ethyl-6-oxo-1H-pyridine-4-carbonyl)pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | CCc1cc(C(=O)N2CCC(NC(=O)Nc3ccc(F)cc3)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H21FN4O3/c1-2-14-9-12(10-17(25)21-14)18(26)24-8-7-16(11-24)23-19(27)22-15-5-3-13(20)4-6-15/h3-6,9-10,16H,2,7-8,11H2,1H3,(H,21,25)(H2,22,23,27) |
| InChIKey | GQDZYDATFWRLMQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |