C21H29FN2O — CID 119736886
2-(8-azabicyclo[3.2.1]octan-3-yl)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]ethanone (PubChem CID 119736886) has the molecular formula C21H29FN2O and a molecular weight of 344.47 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119736886 |
| Molecular Formula | C21H29FN2O |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CC2CCC(C1)N2)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H29FN2O/c22-18-3-1-2-16(11-18)10-15-6-8-24(9-7-15)21(25)14-17-12-19-4-5-20(13-17)23-19/h1-3,11,15,17,19-20,23H,4-10,12-14H2 |
| InChIKey | WYLFBBGKRWYTLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |