C21H22FNO — CID 76868299
1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 76868299) has the molecular formula C21H22FNO and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 76868299 |
| Molecular Formula | C21H22FNO |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H22FNO/c22-20-8-4-7-19(16-20)15-18-11-13-23(14-12-18)21(24)10-9-17-5-2-1-3-6-17/h1-10,16,18H,11-15H2 |
| InChIKey | PTFGLEDUEIVVNU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|