C18H25FN2O — CID 119296753
(1-aminocyclopentyl)-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone (PubChem CID 119296753) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is (1-aminocyclopentyl)-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | (1-aminocyclopentyl)-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119296753 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1-aminocyclopentyl)-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCC(Cc3cccc(F)c3)CC2)CCCC1 |
| InChI | InChI=1S/C18H25FN2O/c19-16-5-3-4-15(13-16)12-14-6-10-21(11-7-14)17(22)18(20)8-1-2-9-18/h3-5,13-14H,1-2,6-12,20H2 |
| InChIKey | TUVVUPYFUYOYQJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |