C19H25FN2O — CID 154864233
5-azaspiro[2.4]heptan-2-yl-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone (PubChem CID 154864233) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is 5-azaspiro[2.4]heptan-2-yl-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | 5-azaspiro[2.4]heptan-2-yl-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 154864233 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 5-azaspiro[2.4]heptan-2-yl-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC12CCNC2)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H25FN2O/c20-16-3-1-2-15(11-16)10-14-4-8-22(9-5-14)18(23)17-12-19(17)6-7-21-13-19/h1-3,11,14,17,21H,4-10,12-13H2 |
| InChIKey | NEIGWXSMFFJVSA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |