C20H20FN3O — CID 71938369
[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-(1H-indazol-4-yl)methanone (PubChem CID 71938369) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is [4-[(3-fluorophenyl)methyl]piperidin-1-yl]-(1H-indazol-4-yl)methanone.
| Compound Name | [4-[(3-fluorophenyl)methyl]piperidin-1-yl]-(1H-indazol-4-yl)methanone |
|---|---|
| PubChem CID | 71938369 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [4-[(3-fluorophenyl)methyl]piperidin-1-yl]-(1H-indazol-4-yl)methanone |
| SMILES | O=C(c1cccc2[nH]ncc12)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H20FN3O/c21-16-4-1-3-15(12-16)11-14-7-9-24(10-8-14)20(25)17-5-2-6-19-18(17)13-22-23-19/h1-6,12-14H,7-11H2,(H,22,23) |
| InChIKey | DIGRVLNWOITUJN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |