C19H30F3N3O2S — CID 145475089
1-(1-tert-butylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea;ethane (PubChem CID 145475089) has the molecular formula C19H30F3N3O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 1-(1-tert-butylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea;ethane.
| Compound Name | 1-(1-tert-butylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea;ethane |
|---|---|
| PubChem CID | 145475089 |
| Molecular Formula | C19H30F3N3O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-(1-tert-butylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea;ethane |
| SMILES | CC.CC(C)(C)SN1CCC(NC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H24F3N3O2S.C2H6/c1-16(2,3)26-23-10-8-13(9-11-23)22-15(24)21-12-4-6-14(7-5-12)25-17(18,19)20;1-2/h4-7,13H,8-11H2,1-3H3,(H2,21,22,24);1-2H3 |
| InChIKey | PIDHMYOKVRGNOL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|