C17H24F3N3O — CID 68609241
1-(1-tert-butylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 68609241) has the molecular formula C17H24F3N3O and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-(1-tert-butylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1-tert-butylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 68609241 |
| Molecular Formula | C17H24F3N3O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-(1-tert-butylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)(C)N1CCC(NC(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H24F3N3O/c1-16(2,3)23-10-8-14(9-11-23)22-15(24)21-13-6-4-12(5-7-13)17(18,19)20/h4-7,14H,8-11H2,1-3H3,(H2,21,22,24) |
| InChIKey | PZGZJMSXKZFLJB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |