C19H19ClF3N3O3S — CID 24899022
1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 24899022) has the molecular formula C19H19ClF3N3O3S and a molecular weight of 461.89 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 24899022 |
| Molecular Formula | C19H19ClF3N3O3S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)NC1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H19ClF3N3O3S/c20-14-3-7-17(8-4-14)30(28,29)26-11-9-16(10-12-26)25-18(27)24-15-5-1-13(2-6-15)19(21,22)23/h1-8,16H,9-12H2,(H2,24,25,27) |
| InChIKey | QSJRTTCVDMNYTE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |