C19H20ClN3O5S — CID 90989791
2-[4-[(4-chlorophenyl)carbamoylamino]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 90989791) has the molecular formula C19H20ClN3O5S and a molecular weight of 437.91 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)carbamoylamino]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-[4-[(4-chlorophenyl)carbamoylamino]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 90989791 |
| Molecular Formula | C19H20ClN3O5S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)carbamoylamino]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCN(S(=O)(=O)c2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C19H20ClN3O5S/c20-13-5-7-14(8-6-13)21-19(26)22-15-9-11-23(12-10-15)29(27,28)17-4-2-1-3-16(17)18(24)25/h1-8,15H,9-12H2,(H,24,25)(H2,21,22,26) |
| InChIKey | VVPJTYFOLLSSCL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |