C19H22F2N4O2 — CID 47049667
1-[4-(difluoromethoxy)phenyl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea (PubChem CID 47049667) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 47049667 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)NC1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C19H22F2N4O2/c20-18(21)27-17-3-1-15(2-4-17)23-19(26)24-16-7-11-25(12-8-16)13-14-5-9-22-10-6-14/h1-6,9-10,16,18H,7-8,11-13H2,(H2,23,24,26) |
| InChIKey | ATGUEKVKAFACPK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |