C16H16F2N2S2 — CID 100585640
1-(2-benzylsulfanylethyl)-3-(2,6-difluorophenyl)thiourea (PubChem CID 100585640) has the molecular formula C16H16F2N2S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-(2,6-difluorophenyl)thiourea.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-(2,6-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 100585640 |
| Molecular Formula | C16H16F2N2S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-(2,6-difluorophenyl)thiourea |
| SMILES | Fc1cccc(F)c1NC(=S)NCCSCc1ccccc1 |
| InChI | InChI=1S/C16H16F2N2S2/c17-13-7-4-8-14(18)15(13)20-16(21)19-9-10-22-11-12-5-2-1-3-6-12/h1-8H,9-11H2,(H2,19,20,21) |
| InChIKey | JOBYEBQJCMJYQL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|