C18H20N2O2S2 — CID 100585828
methyl 3-(2-benzylsulfanylethylcarbamothioylamino)benzoate (PubChem CID 100585828) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is methyl 3-(2-benzylsulfanylethylcarbamothioylamino)benzoate.
| Compound Name | methyl 3-(2-benzylsulfanylethylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100585828 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl 3-(2-benzylsulfanylethylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NCCSCc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O2S2/c1-22-17(21)15-8-5-9-16(12-15)20-18(23)19-10-11-24-13-14-6-3-2-4-7-14/h2-9,12H,10-11,13H2,1H3,(H2,19,20,23) |
| InChIKey | CCBCXFOWBOLQGY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|