C19H21ClN2O2S2 — CID 100587277
ethyl 3-[2-[(2-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate (PubChem CID 100587277) has the molecular formula C19H21ClN2O2S2 and a molecular weight of 408.98 g/mol. Its IUPAC name is ethyl 3-[2-[(2-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate.
| Compound Name | ethyl 3-[2-[(2-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100587277 |
| Molecular Formula | C19H21ClN2O2S2 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | ethyl 3-[2-[(2-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NCCSCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O2S2/c1-2-24-18(23)14-7-5-8-16(12-14)22-19(25)21-10-11-26-13-15-6-3-4-9-17(15)20/h3-9,12H,2,10-11,13H2,1H3,(H2,21,22,25) |
| InChIKey | SDSJEHJEMGIYML-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|