C18H19ClN2O2S2 — CID 100588812
methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate (PubChem CID 100588812) has the molecular formula C18H19ClN2O2S2 and a molecular weight of 394.95 g/mol. Its IUPAC name is methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate.
| Compound Name | methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100588812 |
| Molecular Formula | C18H19ClN2O2S2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NCCSCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H19ClN2O2S2/c1-23-17(22)14-3-2-4-16(11-14)21-18(24)20-9-10-25-12-13-5-7-15(19)8-6-13/h2-8,11H,9-10,12H2,1H3,(H2,20,21,24) |
| InChIKey | HECHYLWVCBKHAD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|