C19H21ClN2O2S2 — CID 100588652
methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate (PubChem CID 100588652) has the molecular formula C19H21ClN2O2S2 and a molecular weight of 408.98 g/mol. Its IUPAC name is methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100588652 |
| Molecular Formula | C19H21ClN2O2S2 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | methyl 3-[2-[(4-chlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)NCCSCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H21ClN2O2S2/c1-13-3-6-15(18(23)24-2)11-17(13)22-19(25)21-9-10-26-12-14-4-7-16(20)8-5-14/h3-8,11H,9-10,12H2,1-2H3,(H2,21,22,25) |
| InChIKey | YPJRWFIHDLCSQU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|