C16H24N3O3S+ — CID 8659740
methyl 4-methyl-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)benzoate (PubChem CID 8659740) has the molecular formula C16H24N3O3S+ and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl 4-methyl-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)benzoate.
| Compound Name | methyl 4-methyl-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 8659740 |
| Molecular Formula | C16H24N3O3S+ |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl 4-methyl-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)NCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C16H23N3O3S/c1-12-3-4-13(15(20)21-2)11-14(12)18-16(23)17-5-6-19-7-9-22-10-8-19/h3-4,11H,5-10H2,1-2H3,(H2,17,18,23)/p+1 |
| InChIKey | QQIVPSJDGKZMCW-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|