C19H20Cl2N2O2S2 — CID 100604662
methyl 3-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate (PubChem CID 100604662) has the molecular formula C19H20Cl2N2O2S2 and a molecular weight of 443.42 g/mol. Its IUPAC name is methyl 3-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100604662 |
| Molecular Formula | C19H20Cl2N2O2S2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | methyl 3-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethylcarbamothioylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)NCCSCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2S2/c1-12-6-7-13(18(24)25-2)10-17(12)23-19(26)22-8-9-27-11-14-15(20)4-3-5-16(14)21/h3-7,10H,8-9,11H2,1-2H3,(H2,22,23,26) |
| InChIKey | GSBWXMAEMCOXMF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|