C22H25Cl2N3OS2 — CID 100605109
1-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea (PubChem CID 100605109) has the molecular formula C22H25Cl2N3OS2 and a molecular weight of 482.50 g/mol. Its IUPAC name is 1-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100605109 |
| Molecular Formula | C22H25Cl2N3OS2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
| SMILES | O=C(c1ccc(NC(=S)NCCSCc2c(Cl)cccc2Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H25Cl2N3OS2/c23-19-5-4-6-20(24)18(19)15-30-14-11-25-22(29)26-17-9-7-16(8-10-17)21(28)27-12-2-1-3-13-27/h4-10H,1-3,11-15H2,(H2,25,26,29) |
| InChIKey | POKYYDDAEQAOOP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|