C22H23N3S2 — CID 100569550
1-(4-anilinophenyl)-3-(2-benzylsulfanylethyl)thiourea (PubChem CID 100569550) has the molecular formula C22H23N3S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-(2-benzylsulfanylethyl)thiourea.
| Compound Name | 1-(4-anilinophenyl)-3-(2-benzylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 100569550 |
| Molecular Formula | C22H23N3S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-(4-anilinophenyl)-3-(2-benzylsulfanylethyl)thiourea |
| SMILES | S=C(NCCSCc1ccccc1)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3S2/c26-22(23-15-16-27-17-18-7-3-1-4-8-18)25-21-13-11-20(12-14-21)24-19-9-5-2-6-10-19/h1-14,24H,15-17H2,(H2,23,25,26) |
| InChIKey | GMCLLKQVZKNUOO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|