C17H23N4S+ — CID 8615902
2-[(4-anilinophenyl)carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8615902) has the molecular formula C17H23N4S+ and a molecular weight of 315.47 g/mol. Its IUPAC name is 2-[(4-anilinophenyl)carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[(4-anilinophenyl)carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8615902 |
| Molecular Formula | C17H23N4S+ |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[(4-anilinophenyl)carbamothioylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H22N4S/c1-21(2)13-12-18-17(22)20-16-10-8-15(9-11-16)19-14-6-4-3-5-7-14/h3-11,19H,12-13H2,1-2H3,(H2,18,20,22)/p+1 |
| InChIKey | GSZCWJOXTIAEFL-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|