C11H19N4S+ — CID 8657059
2-(anilinocarbamothioylamino)ethyl-dimethylazanium (PubChem CID 8657059) has the molecular formula C11H19N4S+ and a molecular weight of 239.37 g/mol. Its IUPAC name is 2-(anilinocarbamothioylamino)ethyl-dimethylazanium.
| Compound Name | 2-(anilinocarbamothioylamino)ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8657059 |
| Molecular Formula | C11H19N4S+ |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(anilinocarbamothioylamino)ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)NNc1ccccc1 |
| InChI | InChI=1S/C11H18N4S/c1-15(2)9-8-12-11(16)14-13-10-6-4-3-5-7-10/h3-7,13H,8-9H2,1-2H3,(H2,12,14,16)/p+1 |
| InChIKey | FELVTFLNJUMVMY-UHFFFAOYSA-O |
| XLogP | -0.38 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|