C12H21N4S+ — CID 8668755
dimethyl-[2-[(3-methylanilino)carbamothioylamino]ethyl]azanium (PubChem CID 8668755) has the molecular formula C12H21N4S+ and a molecular weight of 253.40 g/mol. Its IUPAC name is dimethyl-[2-[(3-methylanilino)carbamothioylamino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(3-methylanilino)carbamothioylamino]ethyl]azanium |
|---|---|
| PubChem CID | 8668755 |
| Molecular Formula | C12H21N4S+ |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | dimethyl-[2-[(3-methylanilino)carbamothioylamino]ethyl]azanium |
| SMILES | Cc1cccc(NNC(=S)NCC[NH+](C)C)c1 |
| InChI | InChI=1S/C12H20N4S/c1-10-5-4-6-11(9-10)14-15-12(17)13-7-8-16(2)3/h4-6,9,14H,7-8H2,1-3H3,(H2,13,15,17)/p+1 |
| InChIKey | GUASVEFTAHBOSM-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|