C15H20N3OS+ — CID 8617103
2-[(5-hydroxynaphthalen-1-yl)carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8617103) has the molecular formula C15H20N3OS+ and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[(5-hydroxynaphthalen-1-yl)carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[(5-hydroxynaphthalen-1-yl)carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8617103 |
| Molecular Formula | C15H20N3OS+ |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[(5-hydroxynaphthalen-1-yl)carbamothioylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C15H19N3OS/c1-18(2)10-9-16-15(20)17-13-7-3-6-12-11(13)5-4-8-14(12)19/h3-8,19H,9-10H2,1-2H3,(H2,16,17,20)/p+1 |
| InChIKey | KARPFZACLLHOFZ-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 48.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|