C23H23ClN2S3 — CID 100587130
1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100587130) has the molecular formula C23H23ClN2S3 and a molecular weight of 459.11 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100587130 |
| Molecular Formula | C23H23ClN2S3 |
| Molecular Weight | 459.11 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | S=C(NCCSCc1ccccc1Cl)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23ClN2S3/c24-22-9-5-4-6-19(22)17-28-15-14-25-23(27)26-20-12-10-18(11-13-20)16-29-21-7-2-1-3-8-21/h1-13H,14-17H2,(H2,25,26,27) |
| InChIKey | QBWCGPUWWRNYTL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.11 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|