C22H21ClN2OS2 — CID 100749903
1-[2-(2-chlorophenoxy)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100749903) has the molecular formula C22H21ClN2OS2 and a molecular weight of 429.01 g/mol. Its IUPAC name is 1-[2-(2-chlorophenoxy)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[2-(2-chlorophenoxy)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100749903 |
| Molecular Formula | C22H21ClN2OS2 |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-[2-(2-chlorophenoxy)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | S=C(NCCOc1ccccc1Cl)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21ClN2OS2/c23-20-8-4-5-9-21(20)26-15-14-24-22(27)25-18-12-10-17(11-13-18)16-28-19-6-2-1-3-7-19/h1-13H,14-16H2,(H2,24,25,27) |
| InChIKey | YBXMKLSEYGXWIN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|