C23H25N3S2 — CID 100682404
1-[2-(N-methylanilino)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100682404) has the molecular formula C23H25N3S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is 1-[2-(N-methylanilino)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[2-(N-methylanilino)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100682404 |
| Molecular Formula | C23H25N3S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[2-(N-methylanilino)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | CN(CCNC(=S)Nc1ccc(CSc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3S2/c1-26(21-8-4-2-5-9-21)17-16-24-23(27)25-20-14-12-19(13-15-20)18-28-22-10-6-3-7-11-22/h2-15H,16-18H2,1H3,(H2,24,25,27) |
| InChIKey | GZHMJSIZRNJKQI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|