C23H24N2OS2 — CID 100591769
1-[2-(4-methoxyphenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100591769) has the molecular formula C23H24N2OS2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100591769 |
| Molecular Formula | C23H24N2OS2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2ccc(CSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2OS2/c1-26-21-13-9-18(10-14-21)15-16-24-23(27)25-20-11-7-19(8-12-20)17-28-22-5-3-2-4-6-22/h2-14H,15-17H2,1H3,(H2,24,25,27) |
| InChIKey | DAEBKGJQBBFYFO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|