C21H29N3S — CID 74225556
1-(4-tert-butylphenyl)-3-[3-(N-methylanilino)propyl]thiourea (PubChem CID 74225556) has the molecular formula C21H29N3S and a molecular weight of 355.55 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-(N-methylanilino)propyl]thiourea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-(N-methylanilino)propyl]thiourea |
|---|---|
| PubChem CID | 74225556 |
| Molecular Formula | C21H29N3S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-(N-methylanilino)propyl]thiourea |
| SMILES | CN(CCCNC(=S)Nc1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H29N3S/c1-21(2,3)17-11-13-18(14-12-17)23-20(25)22-15-8-16-24(4)19-9-6-5-7-10-19/h5-7,9-14H,8,15-16H2,1-4H3,(H2,22,23,25) |
| InChIKey | DASISXIRTWJJPU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|