C20H27N3S — CID 5197733
1-[3-(N-methylanilino)propyl]-3-(2,4,5-trimethylphenyl)thiourea (PubChem CID 5197733) has the molecular formula C20H27N3S and a molecular weight of 341.52 g/mol. Its IUPAC name is 1-[3-(N-methylanilino)propyl]-3-(2,4,5-trimethylphenyl)thiourea.
| Compound Name | 1-[3-(N-methylanilino)propyl]-3-(2,4,5-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 5197733 |
| Molecular Formula | C20H27N3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[3-(N-methylanilino)propyl]-3-(2,4,5-trimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)NCCCN(C)c2ccccc2)cc1C |
| InChI | InChI=1S/C20H27N3S/c1-15-13-17(3)19(14-16(15)2)22-20(24)21-11-8-12-23(4)18-9-6-5-7-10-18/h5-7,9-10,13-14H,8,11-12H2,1-4H3,(H2,21,22,24) |
| InChIKey | IXZXYTWIBYJOOO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|