C28H32N2O2S2 — CID 100755782
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea (PubChem CID 100755782) has the molecular formula C28H32N2O2S2 and a molecular weight of 492.71 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea |
|---|---|
| PubChem CID | 100755782 |
| Molecular Formula | C28H32N2O2S2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-methoxyphenyl)sulfanylpropyl]thiourea |
| SMILES | COc1ccc(SCCCNC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C28H32N2O2S2/c1-28(2,3)22-11-9-20(10-12-22)26(31)21-7-5-8-23(19-21)30-27(33)29-17-6-18-34-25-15-13-24(32-4)14-16-25/h5,7-16,19H,6,17-18H2,1-4H3,(H2,29,30,33) |
| InChIKey | GHEPCMPHJIAOAF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|