C16H14N2O4S — CID 802596
3-[(4-methoxybenzoyl)carbamothioylamino]benzoic acid (PubChem CID 802596) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 3-[(4-methoxybenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3-[(4-methoxybenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 802596 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-[(4-methoxybenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H14N2O4S/c1-22-13-7-5-10(6-8-13)14(19)18-16(23)17-12-4-2-3-11(9-12)15(20)21/h2-9H,1H3,(H,20,21)(H2,17,18,19,23) |
| InChIKey | XJBPCONFEIGMOX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|