C28H31FN2OS2 — CID 100698016
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea (PubChem CID 100698016) has the molecular formula C28H31FN2OS2 and a molecular weight of 494.70 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea |
|---|---|
| PubChem CID | 100698016 |
| Molecular Formula | C28H31FN2OS2 |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cccc(NC(=S)NCCCSCc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C28H31FN2OS2/c1-28(2,3)23-14-12-20(13-15-23)26(32)21-9-6-10-24(18-21)31-27(33)30-16-7-17-34-19-22-8-4-5-11-25(22)29/h4-6,8-15,18H,7,16-17,19H2,1-3H3,(H2,30,31,33) |
| InChIKey | GNWHUCALUDDVON-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|