C27H29NO2S — CID 46778480
3-benzylsulfanyl-N-[3-(4-tert-butylbenzoyl)phenyl]propanamide (PubChem CID 46778480) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-[3-(4-tert-butylbenzoyl)phenyl]propanamide.
| Compound Name | 3-benzylsulfanyl-N-[3-(4-tert-butylbenzoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46778480 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-benzylsulfanyl-N-[3-(4-tert-butylbenzoyl)phenyl]propanamide |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cccc(NC(=O)CCSCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H29NO2S/c1-27(2,3)23-14-12-21(13-15-23)26(30)22-10-7-11-24(18-22)28-25(29)16-17-31-19-20-8-5-4-6-9-20/h4-15,18H,16-17,19H2,1-3H3,(H,28,29) |
| InChIKey | NEIWODPLCKBAEA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|