C27H29ClN2OS — CID 100673124
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-chlorophenyl)propyl]thiourea (PubChem CID 100673124) has the molecular formula C27H29ClN2OS and a molecular weight of 465.06 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-chlorophenyl)propyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-chlorophenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100673124 |
| Molecular Formula | C27H29ClN2OS |
| Molecular Weight | 465.06 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-chlorophenyl)propyl]thiourea |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cccc(NC(=S)NCCCc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C27H29ClN2OS/c1-27(2,3)22-13-11-20(12-14-22)25(31)21-7-4-8-24(18-21)30-26(32)29-17-5-6-19-9-15-23(28)16-10-19/h4,7-16,18H,5-6,17H2,1-3H3,(H2,29,30,32) |
| InChIKey | BBGPBUKRQLONNS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.06 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|